ChemNet > CAS > 23136-39-2 2-Acetyl-5-nitrobenzo[b]furan
23136-39-2 2-Acetyl-5-nitrobenzo[b]furan
Nazwa produktu: |
2-Acetyl-5-nitrobenzo[b]furan |
Angielska nazwa |
2-Acetyl-5-nitrobenzo[b]furan; Methyl 5-nitrobenzo[b]furanyl ketone; 1-(5-nitro-1-benzofuran-2-yl)ethanone |
MF |
C10H7NO4 |
Masie cząsteczkowej |
205.1669 |
InChI |
InChI=1/C10H7NO4/c1-6(12)10-5-7-4-8(11(13)14)2-3-9(7)15-10/h2-5H,1H3 |
Nr CAS |
23136-39-2 |
Struktury molekularnej |
|
Gęstość |
1.37g/cm3 |
Temperatura wrzenia |
350.1°C at 760 mmHg |
Współczynnik załamania |
1.625 |
Temperatura zapłonu |
165.5°C |
Ciśnienie pary |
4.5E-05mmHg at 25°C |
Symbole zagrożenia |
|
Kody ryzyka |
|
Bezpieczeństwo opis |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|